loading...| Preferred Name |
selenoneine |
| Synonyms |
selenoergothioneine (2S)-3-(2-selenoxo-2,3-dihydro-1H-imidazol-4-yl)-2-(trimethylazaniumyl)propanoate 2-selenyl-N(alpha),N(alpha),N(alpha)-trimethyl-L-histidine selenoneine |
| Definitions |
A histidine derivative that is N(alpha),N(alpha),N(alpha)-trimethyl-L-histidine substituted by a selenoxo group at position 2 on the imidazole ring. A selenium-containing antioxidant found in tuna blood. |
| ID |
http://purl.obolibrary.org/obo/CHEBI_79071 |
| charge |
0 |
| database_cross_reference |
PMID:23434904 MetaCyc:CPD-17041 PMID:21331438 Reaxys:15579936 PMID:20388714 PMID:24828577 PMID:24197605 PMID:22129736 PMID:21540999 PMCID:PMC4117592 PMID:23709046 |
| definition |
A histidine derivative that is N(alpha),N(alpha),N(alpha)-trimethyl-L-histidine substituted by a selenoxo group at position 2 on the imidazole ring. A selenium-containing antioxidant found in tuna blood. |
| formula |
C9H15N3O2Se |
| has role |
http://purl.obolibrary.org/obo/CHEBI_22586 |
| has_alternative_id |
CHEBI:82733 |
| has_exact_synonym |
(2S)-3-(2-selenoxo-2,3-dihydro-1H-imidazol-4-yl)-2-(trimethylazaniumyl)propanoate selenoneine |
| has_obo_namespace |
chebi_ontology |
| has_related_synonym |
selenoergothioneine 2-selenyl-N(alpha),N(alpha),N(alpha)-trimethyl-L-histidine |
| id |
CHEBI:79071 |
| in_subset | |
| inchi |
InChI=1S/C9H15N3O2Se/c1-12(2,3)7(8(13)14)4-6-5-10-9(15)11-6/h5,7H,4H2,1-3H3,(H2-,10,11,13,14,15)/t7-/m0/s1 |
| inchikey |
MTIQLELFQVCRSW-ZETCQYMHSA-N |
| label |
selenoneine |
| mass |
276.19000 |
| monoisotopicmass |
277.03295 |
| notation |
CHEBI:79071 |
| prefLabel |
selenoneine |
| smiles |
C[N+](C)(C)[C@@H](Cc1c[nH][c](=[Se])[nH]1)C([O-])=O |
| treeView | |
| subClassOf |
| Delete | Mapping To | Ontology | Source |
|---|---|---|---|
| http://purl.bioontology.org/ontology/MESH/C550322 | Medical Subject Headings / 医学主题词表 | LOOM |