loading...| Preferred Name |
inosine |
| Synonyms |
hypoxanthine D-riboside Inosine 9-beta-D-ribofuranosylhypoxanthine (2R,3S,4R,5R)-2-(hydroxymethyl)-5-(6-hydroxy-9H-purin-9-yl)tetrahydrofuran-3,4-diol 9-beta-D-ribofuranosyl-9H-purin-6-ol hypoxanthosine INOSINE Inosin inosinum inosine i inosina 9-(beta-D-ribofuranosyl)-9H-purin-6-ol |
| Definitions |
A purine nucleoside in which hypoxanthine is attached to ribofuranose via a beta-N(9)-glycosidic bond. |
| ID |
http://purl.obolibrary.org/obo/CHEBI_17596 |
| charge |
0 |
| database_cross_reference |
KEGG:C00294 PMID:22770225 KNApSAcK:C00019692 CAS:58-63-9 ECMDB:ECMDB00195 Drug_Central:3301 HMDB:HMDB0000195 YMDB:YMDB00510 KEGG:D00054 Beilstein:624889 PDBeChem:NOS Gmelin:489332 MetaCyc:INOSINE Wikipedia:Inosine Reaxys:624889 |
| definition |
A purine nucleoside in which hypoxanthine is attached to ribofuranose via a beta-N(9)-glycosidic bond. |
| formula |
C10H12N4O5 |
| has functional parent | |
| has role |
http://purl.obolibrary.org/obo/CHEBI_75771 http://purl.obolibrary.org/obo/CHEBI_77746 |
| has_alternative_id |
CHEBI:14456 CHEBI:5927 CHEBI:44407 CHEBI:24841 |
| has_exact_synonym |
Inosine (2R,3S,4R,5R)-2-(hydroxymethyl)-5-(6-hydroxy-9H-purin-9-yl)tetrahydrofuran-3,4-diol INOSINE inosine 9-(beta-D-ribofuranosyl)-9H-purin-6-ol |
| has_obo_namespace |
chebi_ontology |
| has_related_synonym |
hypoxanthine D-riboside 9-beta-D-ribofuranosylhypoxanthine 9-beta-D-ribofuranosyl-9H-purin-6-ol hypoxanthosine Inosin inosinum inosine i inosina |
| id |
CHEBI:17596 |
| in_subset | |
| inchi |
InChI=1S/C10H12N4O5/c15-1-4-6(16)7(17)10(19-4)14-3-13-5-8(14)11-2-12-9(5)18/h2-4,6-7,10,15-17H,1H2,(H,11,12,18)/t4-,6-,7-,10-/m1/s1 |
| inchikey |
UGQMRVRMYYASKQ-KQYNXXCUSA-N |
| label |
inosine |
| mass |
268.22610 |
| monoisotopicmass |
268.08077 |
| notation |
CHEBI:17596 |
| prefLabel |
inosine |
| smiles |
OC[C@H]1O[C@H]([C@H](O)[C@@H]1O)n1cnc2c(O)ncnc12 |
| treeView | |
| subClassOf |